EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N3O.Cl |
| Net Charge | 0 |
| Average Mass | 353.853 |
| Monoisotopic Mass | 353.12949 |
| SMILES | CCN(CC)c1ccc2nc3c(cc(N)c4ccccc43)[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C20H20N3O.ClH/c1-3-23(4-2)13-9-10-17-18(11-13)24-19-12-16(21)14-7-5-6-8-15(14)20(19)22-17;/h5-12H,3-4,21H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XJCPMUIIBDVFDM-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nile blue A (CHEBI:52163) has part nile blue(1+) (CHEBI:52168) |
| nile blue A (CHEBI:52163) has role fluorochrome (CHEBI:51217) |
| nile blue A (CHEBI:52163) has role histological dye (CHEBI:77178) |
| nile blue A (CHEBI:52163) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 5-amino-9-(diethylamino)benzo[a]phenoxazin-7-ium chloride |
| Synonyms | Source |
|---|---|
| basic blue 12 | ChEBI |
| Benzo(a)phenazoxonium, 5-amino-9-(diethylamino)-,chloride | ChemIDplus |
| C.I. 51180 | ChemIDplus |
| C.I. Basic Blue 12 | ChemIDplus |
| Cresol Fast Violet | ChemIDplus |
| Cresyl Fast Violet | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3923952 | Reaxys |
| CAS:2381-85-3 | ChemIDplus |
| Citations |
|---|