EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20ClN3 |
| Net Charge | 0 |
| Average Mass | 325.843 |
| Monoisotopic Mass | 325.13458 |
| SMILES | Clc1ccc(Cn2c(CN3CCCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20ClN3/c20-16-9-7-15(8-10-16)13-23-18-6-2-1-5-17(18)21-19(23)14-22-11-3-4-12-22/h1-2,5-10H,3-4,11-14H2 |
| InChIKey | CJXAEXPPLWQRFR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| Application: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clemizole (CHEBI:52140) has parent hydride 1H-benzimidazole (CHEBI:41275) |
| clemizole (CHEBI:52140) has role histamine antagonist (CHEBI:37956) |
| clemizole (CHEBI:52140) is a benzimidazoles (CHEBI:22715) |
| clemizole (CHEBI:52140) is a monochlorobenzenes (CHEBI:83403) |
| clemizole (CHEBI:52140) is a pyrrolidines (CHEBI:38260) |
| clemizole (CHEBI:52140) is conjugate base of clemizole(1+) (CHEBI:52146) |
| Incoming Relation(s) |
| clemizole(1+) (CHEBI:52146) is conjugate acid of clemizole (CHEBI:52140) |
| IUPAC Name |
|---|
| 1-(4-chlorobenzyl)-2-(pyrrolidin-1-ylmethyl)-1H-benzimidazole |
| INNs | Source |
|---|---|
| clemizol | ChemIDplus |
| clemizole | ChemIDplus |
| clemizolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(p-Chlorobenzyl)-2-pyrrolidylmethylenebenzimidazole | ChemIDplus |
| Depocural | NIST Chemistry WebBook |
| Lergopenin | NIST Chemistry WebBook |
| Citations |
|---|