EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29N2O7S2.Na |
| Net Charge | 0 |
| Average Mass | 580.660 |
| Monoisotopic Mass | 580.13139 |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(S(=O)(=O)[O-])cc3S(=O)(=O)[O-])c3ccc(N(CC)CC)cc3[o+]c2c1.[Na+] |
| InChI | InChI=1S/C27H30N2O7S2.Na/c1-5-28(6-2)18-9-12-21-24(15-18)36-25-16-19(29(7-3)8-4)10-13-22(25)27(21)23-14-11-20(37(30,31)32)17-26(23)38(33,34)35;/h9-17H,5-8H2,1-4H3,(H-,30,31,32,33,34,35);/q;+1/p-1 |
| InChIKey | SXQCTESRRZBPHJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine rhodamine (CHEBI:52101) has part lissamine rhodamine anion (CHEBI:52866) |
| lissamine rhodamine (CHEBI:52101) has role fluorescent probe (CHEBI:39442) |
| lissamine rhodamine (CHEBI:52101) has role fluorochrome (CHEBI:51217) |
| lissamine rhodamine (CHEBI:52101) has role histological dye (CHEBI:77178) |
| lissamine rhodamine (CHEBI:52101) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 4-[3,6-bis(diethylamino)xanthenium-9-yl]benzene-1,3-disulfonate |
| Synonyms | Source |
|---|---|
| Acid Red 52 | ChemIDplus |
| Acid Red XB | ChemIDplus |
| Acid Rhodamine B | ChemIDplus |
| Amido Rhodamine B | ChemIDplus |
| C.I. 45100 | ChEBI |
| Food Red 106 | ChemIDplus |
| Citations |
|---|