EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | [H][C@@]12Oc3cc(O)ccc3[C@]1(O)COc1cc3c(cc12)C[C@@H](C(=C)C)O3 |
| InChI | InChI=1S/C20H18O5/c1-10(2)15-6-11-5-13-17(8-16(11)24-15)23-9-20(22)14-4-3-12(21)7-18(14)25-19(13)20/h3-5,7-8,15,19,21-22H,1,6,9H2,2H3/t15-,19-,20+/m0/s1 |
| InChIKey | MIYTVBARXCVVHZ-RYGJVYDSSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyceollin III (CHEBI:52086) has role anti-estrogen (CHEBI:50751) |
| glyceollin III (CHEBI:52086) has role antifungal agent (CHEBI:35718) |
| glyceollin III (CHEBI:52086) has role phytoalexin (CHEBI:26115) |
| glyceollin III (CHEBI:52086) is a benzofuropyranochromene (CHEBI:52130) |
| IUPAC Name |
|---|
| (2S,6aS,11aS)-2-(prop-1-en-2-yl)-1,2-dihydro-6H-[1]benzofuro[3,2-c]furo[3,2-g]chromene-6a,9(11aH)-diol |
| UniProt Name | Source |
|---|---|
| glyceollin III | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00009685 | KNApSAcK |
| C15511 | KEGG COMPOUND |
| Glyceollin_III | Wikipedia |
| WO2012006750 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1268819 | Reaxys |
| CAS:61080-23-7 | KEGG COMPOUND |
| CAS:61080-23-7 | ChemIDplus |
| CAS:61080-23-7 | SUBMITTER |
| Citations |
|---|