EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:52072 - ethyl eosin
| Formula | C22H11Br4O5.K |
| Net Charge | 0 |
| Average Mass | 714.039 |
| Monoisotopic Mass | 709.69770 |
| SMILES | CCOC(=O)c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(Br)c([O-])c(Br)cc12.[K+] |
| InChI | InChI=1S/C22H12Br4O5.K/c1-2-30-22(29)10-6-4-3-5-9(10)15-11-7-13(23)18(27)16(25)20(11)31-21-12(15)8-14(24)19(28)17(21)26;/h3-8,27H,2H2,1H3;/q;+1/p-1 |
| InChIKey | UKZQEOHHLOYJLY-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl eosin (CHEBI:52072) has part ethyl eosin anion (CHEBI:52844) |
| ethyl eosin (CHEBI:52072) has role fluorochrome (CHEBI:51217) |
| ethyl eosin (CHEBI:52072) has role histological dye (CHEBI:77178) |
| ethyl eosin (CHEBI:52072) has role photosensitizing agent (CHEBI:47868) |
| ethyl eosin (CHEBI:52072) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium 2,4,5,7-tetrabromo-9-{2-[(ethyloxy)carbonyl]phenyl}-3-oxo-3H-xanthen-6-olate |
| Synonyms | Source |
|---|---|
| Potassium ethyl o-(2,4,5,7-tetrabromo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate | ChemIDplus |
| alcohol soluble eosin | ChEBI |
| C.I. 45386 | ChEBI |
| spirit soluble eosin | ChEBI |
| solvent red 45 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:6359-05-3 | ChemIDplus |
| Citations |
|---|