EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2O6S |
| Net Charge | -1 |
| Average Mass | 379.414 |
| Monoisotopic Mass | 379.09693 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C17H20N2O6S/c1-17(2)12(16(22)23)19-14(21)11(15(19)26-17)18-13(20)10-8(24-3)6-5-7-9(10)25-4/h5-7,11-12,15H,1-4H3,(H,18,20)(H,22,23)/p-1/t11-,12+,15-/m1/s1 |
| InChIKey | RJQXTJLFIWVMTO-TYNCELHUSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methicillin(1−) (CHEBI:52064) is a penicillinate anion (CHEBI:51356) |
| methicillin(1−) (CHEBI:52064) is conjugate base of methicillin (CHEBI:6827) |
| Incoming Relation(s) |
| methicillin sodium (CHEBI:52065) has part methicillin(1−) (CHEBI:52064) |
| methicillin (CHEBI:6827) is conjugate acid of methicillin(1−) (CHEBI:52064) |
| IUPAC Name |
|---|
| 6β-(2,6-dimethoxybenzamido)-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-[(2,6-dimethoxybenzoyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| 6β-(2,6-dimethoxybenzamido)penicillanate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4770226 | Beilstein |