EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N3O4S |
| Net Charge | -1 |
| Average Mass | 388.469 |
| Monoisotopic Mass | 388.13365 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2N1C(=O)[C@@H](c2ccccc2)NC1(C)C |
| InChI | InChI=1S/C19H23N3O4S/c1-18(2)13(17(25)26)21-15(24)12(16(21)27-18)22-14(23)11(20-19(22,3)4)10-8-6-5-7-9-10/h5-9,11-13,16,20H,1-4H3,(H,25,26)/p-1/t11-,12-,13+,16-/m1/s1 |
| InChIKey | DXVUYOAEDJXBPY-NFFDBFGFSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hetacillin(1−) (CHEBI:52059) is a penicillinate anion (CHEBI:51356) |
| hetacillin(1−) (CHEBI:52059) is conjugate base of hetacillin (CHEBI:5683) |
| Incoming Relation(s) |
| hetacillin potassium (CHEBI:34789) has part hetacillin(1−) (CHEBI:52059) |
| hetacillin (CHEBI:5683) is conjugate acid of hetacillin(1−) (CHEBI:52059) |
| IUPAC Name |
|---|
| 6β-[(4R)-2,2-dimethyl-5-oxo-4-phenylimidazolidin-1-yl]-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-[(4R)-2,2-dimethyl-5-oxo-4-phenylimidazolidin-1-yl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| 6β-[(4R)-2,2-dimethyl-5-oxo-4-phenylimidazolidin-1-yl]penicillanate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5405766 | Beilstein |