EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C41H46N8.4Cl |
| Net Charge | 0 |
| Average Mass | 794.703 |
| Monoisotopic Mass | 792.27560 |
| SMILES | Cc1c2cc(N)ccc2c2ccc(N)cc2[n+]1CCCNCCNCCC[n+]1c(-c2ccccc2)c2cc(N)ccc2c2ccc(N)cc21.[Cl-].[Cl-].[Cl-].[Cl-].[H+].[H+] |
| InChI | InChI=1S/C41H44N8.4ClH/c1-27-37-23-29(42)9-13-33(37)35-15-11-31(44)25-39(35)48(27)21-5-17-46-19-20-47-18-6-22-49-40-26-32(45)12-16-36(40)34-14-10-30(43)24-38(34)41(49)28-7-3-2-4-8-28;;;;/h2-4,7-16,23-26,44-47H,5-6,17-22,42-43H2,1H3;4*1H |
| InChIKey | GTSMOYLSFUBTMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethidium homodimer (CHEBI:52055) has functional parent ethidium (CHEBI:42478) |
| ethidium homodimer (CHEBI:52055) has part ethidium homodimer tetracation (CHEBI:52843) |
| ethidium homodimer (CHEBI:52055) has role fluorochrome (CHEBI:51217) |
| ethidium homodimer (CHEBI:52055) has role intercalator (CHEBI:24853) |
| ethidium homodimer (CHEBI:52055) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3,8-diamino-5-{3-[(2-{[3-(3,8-diamino-6-methylphenanthridinium-5-yl)propyl]amino}ethyl)amino]propyl}-6-phenylphenanthridinium dichloride dihydrochloride |
| Synonyms | Source |
|---|---|
| 5,5'-(4,7-Diazadecamethylene)-bis(3,8-diamino-6-phenylphenanthridinium) dichloride dihydrochloride | ChemIDplus |
| Phenanthridinium, 5,5'-[1,2-ethanediylbis(imino-3,1-propanediyl)]bis(3,8-diamino-6-phenyl)-,dichloride,dihydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:61926-22-5 | ChemIDplus |