EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O7 |
| Net Charge | 0 |
| Average Mass | 374.389 |
| Monoisotopic Mass | 374.13655 |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@@H](OC(=O)C=C(C)C)CC1=C[C@@H](C[C@@]3(C)O[C@H]23)OC1=O |
| InChI | InChI=1S/C20H22O7/c1-9(2)5-14(21)25-13-7-11-6-12(24-19(11)23)8-20(4)17(27-20)16-15(13)10(3)18(22)26-16/h5-6,12-13,15-17H,3,7-8H2,1-2,4H3/t12-,13-,15+,16-,17+,20+/m0/s1 |
| InChIKey | HSTUUCOYVIWGLJ-DXUAHVLSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elephantin (CHEBI:520527) has role antineoplastic agent (CHEBI:35610) |
| elephantin (CHEBI:520527) is a germacrane sesquiterpenoid (CHEBI:68588) |
| IUPAC Name |
|---|
| (1aR,1bS,4aR,5S,10R,11aR)-11a-methyl-4-methylidene-3,8-dioxodecahydro-10,7-(metheno)furo[2,3-f]oxireno[d]oxacycloundecin-5(8H)-yl 3-methylbut-2-enoate |
| Synonyms | Source |
|---|---|
| elephantin | ChEMBL |
| Elephantin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1692285 | Reaxys |
| CAS:21899-50-3 | ChemIDplus |
| CAS:21899-50-3 | KEGG COMPOUND |
| Citations |
|---|