EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C9H10O2/c1-8(10)11-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | QUKGYYKBILRGFE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzyl acetate (CHEBI:52051) has role metabolite (CHEBI:25212) |
| benzyl acetate (CHEBI:52051) is a acetate ester (CHEBI:47622) |
| benzyl acetate (CHEBI:52051) is a benzyl ester (CHEBI:90628) |
| IUPAC Name |
|---|
| phenylmethyl acetate |
| Synonyms | Source |
|---|---|
| Acetic acid, benzyl ester | ChemIDplus |
| Acetic acid, phenylmethyl ester | ChemIDplus |
| Benzyl ethanoate | ChemIDplus |
| Phenylmethyl ethanoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| benzyl acetate | UniProt |