EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O3 |
| Net Charge | 0 |
| Average Mass | 170.208 |
| Monoisotopic Mass | 170.09429 |
| SMILES | CC(C)=CCCC(=O)CC(=O)O |
| InChI | InChI=1S/C9H14O3/c1-7(2)4-3-5-8(10)6-9(11)12/h4H,3,5-6H2,1-2H3,(H,11,12) |
| InChIKey | LWAVSMHUXDEREV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyl-3-oxooct-6-enoic acid (CHEBI:52046) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| 7-methyl-3-oxooct-6-enoic acid (CHEBI:52046) is a branched-chain fatty acid (CHEBI:35819) |
| 7-methyl-3-oxooct-6-enoic acid (CHEBI:52046) is a medium-chain fatty acid (CHEBI:59554) |
| 7-methyl-3-oxooct-6-enoic acid (CHEBI:52046) is a monounsaturated fatty acid (CHEBI:25413) |
| 7-methyl-3-oxooct-6-enoic acid (CHEBI:52046) is a oxo fatty acid (CHEBI:59644) |
| IUPAC Name |
|---|
| 7-methyl-3-oxooct-6-enoic acid |
| Synonyms | Source |
|---|---|
| 7-methyl-3-oxo-6-octenoic acid | ChEBI |
| 7-Methyl-3-oxo-oct-6-ensäure | ChEBI |
| 7-Methyl-3-oxooct-6-ensäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1768618 | Reaxys |