EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7NO3 |
| Net Charge | 0 |
| Average Mass | 189.170 |
| Monoisotopic Mass | 189.04259 |
| SMILES | O=C(O)c1cc(=O)nc2ccccc12 |
| InChI | InChI=1S/C10H7NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | MFSHNFBQNVGXJX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubus chingii (ncbitaxon:714495) | fruit (BTO:0000486) | PubMed (21747716) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxo-1,2-dihydroquinoline-4-carboxylic acid (CHEBI:52045) has role plant metabolite (CHEBI:76924) |
| 2-oxo-1,2-dihydroquinoline-4-carboxylic acid (CHEBI:52045) is a quinolinemonocarboxylic acid (CHEBI:26512) |
| 2-oxo-1,2-dihydroquinoline-4-carboxylic acid (CHEBI:52045) is conjugate acid of 2-oxo-1,2-dihydroquinoline-4-carboxylate (CHEBI:58878) |
| Incoming Relation(s) |
| 2-oxo-1,2-dihydroquinoline-4-carboxylate (CHEBI:58878) is conjugate base of 2-oxo-1,2-dihydroquinoline-4-carboxylic acid (CHEBI:52045) |
| IUPAC Name |
|---|
| 2-oxo-1,2-dihydroquinoline-4-carboxylic acid |
| Synonym | Source |
|---|---|
| 2-oxocinchoninic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16715 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:154678 | Beilstein |
| CAS:15733-89-8 | ChEBI |
| Citations |
|---|