EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O4 |
| Net Charge | 0 |
| Average Mass | 322.445 |
| Monoisotopic Mass | 322.21441 |
| SMILES | CCCCCCCCCCC1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C19H30O4/c1-5-6-7-8-9-10-11-12-13-15-14(2)16(20)18(22-3)19(23-4)17(15)21/h5-13H2,1-4H3 |
| InChIKey | VMEGFMNVSYVVOM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-decylubiquinone (CHEBI:52020) has functional parent 6-decylubiquinol (CHEBI:52021) |
| 6-decylubiquinone (CHEBI:52020) has role cofactor (CHEBI:23357) |
| 6-decylubiquinone (CHEBI:52020) is a 1,4-benzoquinones (CHEBI:132124) |
| IUPAC Name |
|---|
| 2-decyl-5,6-dimethoxy-3-methyl-1,4-benzoquinone |
| Synonyms | Source |
|---|---|
| 2,3-Dimethoxy-5-methyl-6-decyl-1,4-benzoquinone | KEGG COMPOUND |
| 2,3-Dmdb | ChemIDplus |
| 6-Decylubiquinone | KEGG COMPOUND |
| Decyl-ubiquinone | ChemIDplus |
| Decylubiquinone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 6-decylubiquinone | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5070396 | Beilstein |
| CAS:55486-00-5 | KEGG COMPOUND |
| CAS:55486-00-5 | ChemIDplus |
| Citations |
|---|