EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25N2O6S |
| Net Charge | -1 |
| Average Mass | 493.561 |
| Monoisotopic Mass | 493.14388 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)C(C(=O)Oc1ccc2c(c1)CCC2)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O6S/c1-26(2)20(24(31)32)28-22(30)19(23(28)35-26)27-21(29)18(15-7-4-3-5-8-15)25(33)34-17-12-11-14-9-6-10-16(14)13-17/h3-5,7-8,11-13,18-20,23H,6,9-10H2,1-2H3,(H,27,29)(H,31,32)/p-1/t18?,19-,20+,23-/m1/s1 |
| InChIKey | JIRBAUWICKGBFE-MNRDOXJOSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carindacillin(1−) (CHEBI:52016) is a penicillinate anion (CHEBI:51356) |
| carindacillin(1−) (CHEBI:52016) is conjugate base of carindacillin (CHEBI:52015) |
| Incoming Relation(s) |
| carindacillin sodium (CHEBI:31358) has part carindacillin(1−) (CHEBI:52016) |
| carindacillin (CHEBI:52015) is conjugate acid of carindacillin(1−) (CHEBI:52016) |
| IUPAC Name |
|---|
| 6β-[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonyms | Source |
|---|---|
| (2S,5R,6R)-6-{[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| 6β-{2-[(2,3-dihydro-1H-inden-5-yloxy)carbonyl]-2-phenylacetamido}-2,2-dimethylpenam-3α-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406318 | Beilstein |