EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N3O2S |
| Net Charge | 0 |
| Average Mass | 335.473 |
| Monoisotopic Mass | 335.16675 |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCN)cccc12 |
| InChI | InChI=1S/C17H25N3O2S/c1-20(2)16-10-6-9-15-14(16)8-7-11-17(15)23(21,22)19-13-5-3-4-12-18/h6-11,19H,3-5,12-13,18H2,1-2H3 |
| InChIKey | MLEBFEHOJICQQS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.3.2.13 (protein-glutamine gamma-glutamyltransferase) inhibitor An EC 2.3.2.* (aminoacyltransferase) inhibitor that interferes with the action of protein-glutamine γ-glutamyltransferase (EC 2.3.2.13). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monodansylcadaverine (CHEBI:52007) has functional parent cadaverine (CHEBI:18127) |
| monodansylcadaverine (CHEBI:52007) has role EC 2.3.2.13 (protein-glutamine γ-glutamyltransferase) inhibitor (CHEBI:72716) |
| monodansylcadaverine (CHEBI:52007) has role fluorochrome (CHEBI:51217) |
| monodansylcadaverine (CHEBI:52007) has role protective agent (CHEBI:50267) |
| monodansylcadaverine (CHEBI:52007) is a aminonaphthalene (CHEBI:38034) |
| monodansylcadaverine (CHEBI:52007) is a primary amino compound (CHEBI:50994) |
| monodansylcadaverine (CHEBI:52007) is a sulfonamide (CHEBI:35358) |
| monodansylcadaverine (CHEBI:52007) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(5-aminopentyl)-5-(dimethylamino)naphthalene-1-sulfonamide |
| Synonyms | Source |
|---|---|
| dansylcadaverine | ChEBI |
| N-monodansyl-1,5-diaminopentane | ChEBI |
| N-monodansylcadaverine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2951070 | Reaxys |
| CAS:10121-91-2 | ChemIDplus |
| Citations |
|---|