EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O12 |
| Net Charge | 0 |
| Average Mass | 516.455 |
| Monoisotopic Mass | 516.12678 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@@](OC(=O)/C=C/c2ccc(O)c(O)c2)(C(=O)O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(24(34)35,11-19(30)23(20)33)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,33H,11-12H2,(H,34,35)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 |
| InChIKey | YDDUMTOHNYZQPO-RVXRWRFUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-dicaffeoylquinic acid (CHEBI:520) has functional parent (−)-quinic acid (CHEBI:17521) |
| 1,3-dicaffeoylquinic acid (CHEBI:520) has functional parent trans-caffeic acid (CHEBI:16433) |
| 1,3-dicaffeoylquinic acid (CHEBI:520) has role plant metabolite (CHEBI:76924) |
| 1,3-dicaffeoylquinic acid (CHEBI:520) is a alkyl caffeate ester (CHEBI:65331) |
| 1,3-dicaffeoylquinic acid (CHEBI:520) is a quinic acid (CHEBI:26493) |
| 1,3-dicaffeoylquinic acid (CHEBI:520) is conjugate acid of 1,3-dicaffeoylquinate (CHEBI:86332) |
| Incoming Relation(s) |
| 1,3-dicaffeoylquinate (CHEBI:86332) is conjugate base of 1,3-dicaffeoylquinic acid (CHEBI:520) |
| IUPAC Name |
|---|
| (1R,3R,4S,5R)-1,3-bis{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-4,5-dihydroxycyclohexane-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1,5-Dicaffeoylquinic acid | ChEBI |
| Cynarin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3124 | DrugCentral |
| C00002733 | KNApSAcK |
| C10445 | KEGG COMPOUND |
| HMDB0030093 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3189399 | Reaxys |
| CAS:30964-13-7 | KEGG COMPOUND |