EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H36N.F |
| Net Charge | 0 |
| Average Mass | 261.469 |
| Monoisotopic Mass | 261.28318 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[F-] |
| InChI | InChI=1S/C16H36N.FH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | phase-transfer catalyst A catalyst that facilitates the migration of a reactant from one phase into another phase where reaction occurs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrabutylammonium fluoride (CHEBI:51990) has role phase-transfer catalyst (CHEBI:63060) |
| tetrabutylammonium fluoride (CHEBI:51990) is a fluoride salt (CHEBI:24060) |
| tetrabutylammonium fluoride (CHEBI:51990) is a tetrabutylammonium salt (CHEBI:51992) |
| IUPAC Name |
|---|
| N,N,N-tributylbutan-1-aminium fluoride |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3570522 | Reaxys |
| CAS:429-41-4 | ChemIDplus |
| Citations |
|---|