EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7N3O5 |
| Net Charge | 0 |
| Average Mass | 225.160 |
| Monoisotopic Mass | 225.03857 |
| SMILES | [H]C(=NN1CCOC1=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C8H7N3O5/c12-8-10(3-4-15-8)9-5-6-1-2-7(16-6)11(13)14/h1-2,5H,3-4H2 |
| InChIKey | PLHJDBGFXBMTGZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). antitrichomonal drug A drug used to treat trichomonas infections. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antitrichomonal drug A drug used to treat trichomonas infections. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| furazolidone (CHEBI:5195) has role antibacterial drug (CHEBI:36047) |
| furazolidone (CHEBI:5195) has role antiinfective agent (CHEBI:35441) |
| furazolidone (CHEBI:5195) has role antitrichomonal drug (CHEBI:50685) |
| furazolidone (CHEBI:5195) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| furazolidone (CHEBI:5195) is a nitrofuran antibiotic (CHEBI:87230) |
| furazolidone (CHEBI:5195) is a oxazolidines (CHEBI:38329) |
| IUPAC Name |
|---|
| 3-{[(5-nitro-2-furyl)methylene]amino}-1,3-oxazolidin-2-one |
| INNs | Source |
|---|---|
| Furazolidona | ChemIDplus |
| furazolidone | WHO MedNet |
| furazolidone | WHO MedNet |
| Furazolidonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-{[(5-Nitro-2-furanyl)methylene]amino}-2-oxazolidinone | ChemIDplus |
| 3-(5'-Nitrofurfuralamino)-2-oxazolidone | ChemIDplus |
| 3-[(5-Nitrofurfurylidene)amino]-2-oxazolidinone | ChemIDplus |
| 3-[(5-Nitrofurfurylidene)amino]-2-oxazolidone | ChemIDplus |
| 3-[(5-Nitrofurylidene)amino]-2-oxazolidone | ChemIDplus |
| 5-Nitro-N-(2-oxo-3-oxazolidinyl)-2-furanmethanimine | NIST Chemistry WebBook |
| Citations |
|---|