EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N3 |
| Net Charge | +1 |
| Average Mass | 478.704 |
| Monoisotopic Mass | 478.32167 |
| SMILES | CCNc1cc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(N(CC)CC)cc2)cc2ccccc12 |
| InChI | InChI=1S/C33H40N3/c1-6-34-32-24-28(23-27-13-11-12-14-31(27)32)33(25-15-19-29(20-16-25)35(7-2)8-3)26-17-21-30(22-18-26)36(9-4)10-5/h11-24,34H,6-10H2,1-5H3/q+1 |
| InChIKey | CZPLANDPABRVHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cascade blue (CHEBI:51932) has role fluorochrome (CHEBI:51217) |
| cascade blue (CHEBI:51932) is a aminonaphthalene (CHEBI:38034) |
| IUPAC Name |
|---|
| N-(4-{[4-(diethylamino)phenyl][4-(ethylamino)-2-naphthyl]methylene}cyclohexa-2,5-dien-1-ylidene)-N-ethylethanaminium |
| Synonym | Source |
|---|---|
| CI Pigment Blue 1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1325-87-7 | ChemIDplus |