EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H21N2O6S |
| Net Charge | -1 |
| Average Mass | 453.496 |
| Monoisotopic Mass | 453.11258 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)C(C(=O)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O6S/c1-23(2)17(21(28)29)25-19(27)16(20(25)32-23)24-18(26)15(13-9-5-3-6-10-13)22(30)31-14-11-7-4-8-12-14/h3-12,15-17,20H,1-2H3,(H,24,26)(H,28,29)/p-1/t15?,16-,17+,20-/m1/s1 |
| InChIKey | NZDASSHFKWDBBU-KVMCETHSSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carfecillin(1−) (CHEBI:51906) is a penicillinate anion (CHEBI:51356) |
| carfecillin(1−) (CHEBI:51906) is conjugate base of carfecillin (CHEBI:3414) |
| Incoming Relation(s) |
| carfecillin sodium (CHEBI:34612) has part carfecillin(1−) (CHEBI:51906) |
| carfecillin (CHEBI:3414) is conjugate acid of carfecillin(1−) (CHEBI:51906) |
| IUPAC Name |
|---|
| 2,2-dimethyl-6β-[(3-oxo-3-phenoxy-2-phenylpropanoyl)amino]penam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(3-oxo-3-phenoxy-2-phenylpropanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5406126 | Beilstein |