EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N2O6S |
| Net Charge | -2 |
| Average Mass | 376.390 |
| Monoisotopic Mass | 376.07400 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)C(C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H18N2O6S/c1-17(2)11(16(24)25)19-13(21)10(14(19)26-17)18-12(20)9(15(22)23)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,20)(H,22,23)(H,24,25)/p-2/t9?,10-,11+,14-/m1/s1 |
| InChIKey | FPPNZSSZRUTDAP-UWFZAAFLSA-L |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbenicillin(2−) (CHEBI:51897) is a penicillinate anion (CHEBI:51356) |
| carbenicillin(2−) (CHEBI:51897) is conjugate base of carbenicillin (CHEBI:3393) |
| Incoming Relation(s) |
| carbenicillin disodium (CHEBI:34609) has part carbenicillin(2−) (CHEBI:51897) |
| carbenicillin (CHEBI:3393) is conjugate acid of carbenicillin(2−) (CHEBI:51897) |
| IUPAC Name |
|---|
| 6β-(2-carboxylato-2-phenylacetamido)-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-6-{[carboxylato(phenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5394984 | Beilstein |