EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15BF2N2O2 |
| Net Charge | 0 |
| Average Mass | 292.094 |
| Monoisotopic Mass | 292.11946 |
| SMILES | Cc1cc(C)n2c1C=C1C=CC(CCC(=O)O)=[N+]1[B-]2(F)F |
| InChI | InChI=1S/C14H15BF2N2O2/c1-9-7-10(2)18-13(9)8-12-4-3-11(5-6-14(20)21)19(12)15(18,16)17/h3-4,7-8H,5-6H2,1-2H3,(H,20,21) |
| InChIKey | BJDJEJIINKBPHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BODIPY FL (CHEBI:51886) has functional parent 4,4-difluoro-4-bora-3a,4a-diaza-s-indacene (CHEBI:51107) |
| BODIPY FL (CHEBI:51886) has role fluorochrome (CHEBI:51217) |
| BODIPY FL (CHEBI:51886) is a BODIPY dye (CHEBI:51123) |
| BODIPY FL (CHEBI:51886) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3-{5-[(3,5-dimethyl-2H-pyrrol-2-ylidene-κN)methyl]-1H-pyrrol-2-yl-κN}propanoato)(difluoro)boron |
| Synonym | Source |
|---|---|
| 4,4-difluoro-5,7-dimethyl-4-bora-3a,4a-diaza-s-indacene-3-propionic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9347491 | Beilstein |