EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H34N2O4 |
| Net Charge | 0 |
| Average Mass | 510.634 |
| Monoisotopic Mass | 510.25186 |
| SMILES | CCC(C)(C)n1cc(C2=C(O)C(=O)C(c3cn(C(C)(C)CC)c4ccccc34)=C(O)C2=O)c2ccccc21 |
| InChI | InChI=1S/C32H34N2O4/c1-7-31(3,4)33-17-21(19-13-9-11-15-23(19)33)25-27(35)29(37)26(30(38)28(25)36)22-18-34(32(5,6)8-2)24-16-12-10-14-20(22)24/h9-18,35,38H,7-8H2,1-6H3 |
| InChIKey | OXRDUMBQGCRVSK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetrahydroasterriquinone (CHEBI:51884) is a asterriquinones (CHEBI:51880) |
| tetrahydroasterriquinone (CHEBI:51884) is a dihydroxy-1,4-benzoquinones (CHEBI:132126) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-3,6-bis[1-(2-methylbutan-2-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| Registry Numbers | Sources |
|---|---|
| Beilstein:732697 | Beilstein |