EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34N2O4 |
| Net Charge | 0 |
| Average Mass | 534.656 |
| Monoisotopic Mass | 534.25186 |
| SMILES | C=CC(C)(C)n1cc(C2=C(OC)C(=O)C(c3cn(C(C)(C)C=C)c4ccccc34)=C(OC)C2=O)c2ccccc21 |
| InChI | InChI=1S/C34H34N2O4/c1-9-33(3,4)35-19-23(21-15-11-13-17-25(21)35)27-29(37)32(40-8)28(30(38)31(27)39-7)24-20-36(34(5,6)10-2)26-18-14-12-16-22(24)26/h9-20H,1-2H2,3-8H3 |
| InChIKey | XXFUEPJMSRNLDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asterriquinone dimethyl ether (CHEBI:51883) is a asterriquinones (CHEBI:51880) |
| IUPAC Name |
|---|
| 2,5-dimethoxy-3,6-bis[1-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]cyclohexa-2,5-diene-1,4-dione |
| Synonym | Source |
|---|---|
| 2,5-bis[1-(1,1-dimethylallyl)-1H-indol-3-yl]-3,6-dimethoxy-1,4-benzoquinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:734686 | Beilstein |