EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3.HCl |
| Net Charge | 0 |
| Average Mass | 303.837 |
| Monoisotopic Mass | 303.15023 |
| SMILES | CN(C)c1ccc(C(=N)c2ccc(N(C)C)cc2)cc1.Cl |
| InChI | InChI=1S/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H |
| InChIKey | KSCQDDRPFHTIRL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| auramine O (CHEBI:51876) has part auramine O(1+) (CHEBI:87485) |
| auramine O (CHEBI:51876) has role fluorochrome (CHEBI:51217) |
| auramine O (CHEBI:51876) has role histological dye (CHEBI:77178) |
| auramine O (CHEBI:51876) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 4,4'-carbonimidoylbis(N,N-dimethylaniline) hydrochloride |
| bis[4-(dimethylamino)phenyl]methaniminium chloride |
| Synonyms | Source |
|---|---|
| 1,1-Bis(p-dimethylaminophenyl)methylenimine hydrochloride | ChEBI |
| 4,4'-Bis(dimethylamino)-benzhydrylidenimine hydrochloride | ChemIDplus |
| 4:4'-Bis(dimethylamino)benzophenone-imine hydrochloride | ChemIDplus |
| 4,4'-(Imidocarbonyl)bis(N,N-dimethylamine), monohydrochloride | ChemIDplus |
| Auramin | ChemIDplus |
| Auramine Yellow | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Auramine_O | Wikipedia |
| Citations |
|---|