EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3 |
| Net Charge | 0 |
| Average Mass | 267.376 |
| Monoisotopic Mass | 267.17355 |
| SMILES | CN(C)c1ccc(C(=N)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 |
| InChIKey | JPIYZTWMUGTEHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| auramine O free base (CHEBI:51874) has role fluorochrome (CHEBI:51217) |
| auramine O free base (CHEBI:51874) has role histological dye (CHEBI:77178) |
| auramine O free base (CHEBI:51874) is a imine (CHEBI:24783) |
| auramine O free base (CHEBI:51874) is a substituted aniline (CHEBI:48975) |
| auramine O free base (CHEBI:51874) is a tertiary amino compound (CHEBI:50996) |
| auramine O free base (CHEBI:51874) is conjugate base of auramine O(1+) (CHEBI:87485) |
| Incoming Relation(s) |
| auramine O(1+) (CHEBI:87485) is conjugate acid of auramine O free base (CHEBI:51874) |
| IUPAC Name |
|---|
| 4,4'-carbonimidoylbis(N,N-dimethylaniline) |
| Synonyms | Source |
|---|---|
| 4,4'-Dimethylaminobenzophenonimide | ChEBI |
| 4,4'-(Imidocarbonyl)bis(N,N-dimethylaniline) | ChemIDplus |
| Apyonine auramine base | ChemIDplus |
| auramine | ChEBI |
| Auramine (free base) | ChemIDplus |
| Bis(p-dimethylaminophenyl)methyleneimine | ChemIDplus |