EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO2 |
| Net Charge | 0 |
| Average Mass | 233.311 |
| Monoisotopic Mass | 233.14158 |
| SMILES | [H][C@@]1([C@]([H])(C(=O)OC)c2ccccc2)CCCCN1 |
| InChI | InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | DUGOZIWVEXMGBE-QWHCGFSZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (R)-phenyl[(S)-piperidin-2-yl]acetate (CHEBI:51862) is a methyl phenyl(piperidin-2-yl)acetate (CHEBI:84276) |
| methyl (R)-phenyl[(S)-piperidin-2-yl]acetate (CHEBI:51862) is enantiomer of methyl (S)-phenyl[(R)-piperidin-2-yl]acetate (CHEBI:51861) |
| Incoming Relation(s) |
| methyl (S)-phenyl[(R)-piperidin-2-yl]acetate (CHEBI:51861) is enantiomer of methyl (R)-phenyl[(S)-piperidin-2-yl]acetate (CHEBI:51862) |
| IUPAC Name |
|---|
| methyl (2R)-phenyl[(2S)-piperidin-2-yl]acetate |
| Synonyms | Source |
|---|---|
| erythro-(2R,2'S)-methyl phenidate | ChEBI |
| methyl (αR,2S)-phenyl-(piperidin-2-yl)acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7974782 | Reaxys |