EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO2 |
| Net Charge | 0 |
| Average Mass | 233.311 |
| Monoisotopic Mass | 233.14158 |
| SMILES | [H][C@]1([C@]([H])(C(=O)OC)c2ccccc2)CCCCN1 |
| InChI | InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | DUGOZIWVEXMGBE-CHWSQXEVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| Application: | adrenergic agent Any agent that acts on an adrenergic receptor or affects the life cycle of an adrenergic transmitter. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexmethylphenidate (CHEBI:51860) has role adrenergic agent (CHEBI:37962) |
| dexmethylphenidate (CHEBI:51860) is a methyl phenyl(piperidin-2-yl)acetate (CHEBI:84276) |
| dexmethylphenidate (CHEBI:51860) is enantiomer of methyl (S)-phenyl[(S)-piperidin-2-yl]acetate (CHEBI:51857) |
| Incoming Relation(s) |
| methylphenidate (CHEBI:6887) has part dexmethylphenidate (CHEBI:51860) |
| methyl (S)-phenyl[(S)-piperidin-2-yl]acetate (CHEBI:51857) is enantiomer of dexmethylphenidate (CHEBI:51860) |
| IUPAC Name |
|---|
| methyl (2R)-phenyl[(2R)-piperidin-2-yl]acetate |
| INNs | Source |
|---|---|
| dexmethylphenidate | WHO MedNet |
| dexméthylphénidate | WHO MedNet |
| dexmethylphenidatum | WHO MedNet |
| dexmetilfenidato | WHO MedNet |
| Synonyms | Source |
|---|---|
| d-threo-methylphenidate | ChemIDplus |
| (+)-threo-methylphenidate | ChemIDplus |
| methyl (R)-phenyl[(R)-piperidin-2-yl]acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 836 | DrugCentral |
| Dexmethylphenidate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6116309 | Beilstein |
| CAS:40431-64-9 | ChemIDplus |