EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20NO2 |
| Net Charge | +1 |
| Average Mass | 234.319 |
| Monoisotopic Mass | 234.14886 |
| SMILES | COC(=O)C(c1ccccc1)C1CCCC[NH2+]1 |
| InChI | InChI=1S/C14H19NO2/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3/p+1 |
| InChIKey | DUGOZIWVEXMGBE-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylphenidate(1+) (CHEBI:51856) is a ammonium ion derivative (CHEBI:35274) |
| methylphenidate(1+) (CHEBI:51856) is conjugate acid of methylphenidate (CHEBI:6887) |
| Incoming Relation(s) |
| methylphenidate hydrochloride (CHEBI:31836) has part methylphenidate(1+) (CHEBI:51856) |
| methylphenidate (CHEBI:6887) is conjugate base of methylphenidate(1+) (CHEBI:51856) |
| IUPAC Name |
|---|
| 2-(2-methoxy-2-oxo-1-phenylethyl)piperidinium |