EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | O=C1C=CCOC1(O)CO |
| InChI | InChI=1S/C6H8O4/c7-4-6(9)5(8)2-1-3-10-6/h1-2,7,9H,3-4H2 |
| InChIKey | FUJVJJBVXLPRQJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microthecin (CHEBI:51835) has role algal metabolite (CHEBI:84735) |
| microthecin (CHEBI:51835) is a 3-pyrones (CHEBI:131907) |
| IUPAC Name |
|---|
| 2-hydroxy-2-(hydroxymethyl)-2H-pyran-3(6H)-one |
| UniProt Name | Source |
|---|---|
| microthecin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6500287 | Beilstein |