EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O6 |
| Net Charge | 0 |
| Average Mass | 190.151 |
| Monoisotopic Mass | 190.04774 |
| SMILES | CC(=O)[C@@H](O)[C@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H10O6/c1-3(8)6(11)4(9)2-5(10)7(12)13/h4,6,9,11H,2H2,1H3,(H,12,13)/t4-,6-/m1/s1 |
| InChIKey | JBJFMONKIKZMPK-INEUFUBQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-dideoxy-D-threo-hepto-2,6-diuolosonic acid (CHEBI:51822) is a ketoaldonic acid (CHEBI:24963) |
| 3,7-dideoxy-D-threo-hepto-2,6-diuolosonic acid (CHEBI:51822) is conjugate acid of 3,7-dideoxy-D-threo-hepto-2,6-diuolosonate (CHEBI:58868) |
| Incoming Relation(s) |
| 3,7-dideoxy-D-threo-hepto-2,6-diuolosonate (CHEBI:58868) is conjugate base of 3,7-dideoxy-D-threo-hepto-2,6-diuolosonic acid (CHEBI:51822) |
| IUPAC Names |
|---|
| 3,7-dideoxy-D-threo-hepto-2,6-diuolosonic acid |
| (4R,5S)-4,5-dihydroxy-2,6-dioxoheptanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2445058 | Beilstein |
| Citations |
|---|