EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H39N2O5.ClO4 |
| Net Charge | 0 |
| Average Mass | 691.177 |
| Monoisotopic Mass | 690.23441 |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(c1ccc(C(=O)O)cc1C(=O)O)=c1cc2c(cc1O3)=[N+](CC)C(C)(C)C=C2C.O=Cl(=O)(=O)[O-] |
| InChI | InChI=1S/C37H38N2O5.ClHO4/c1-9-38-29-16-31-27(14-24(29)20(3)18-36(38,5)6)33(23-12-11-22(34(40)41)13-26(23)35(42)43)28-15-25-21(4)19-37(7,8)39(10-2)30(25)17-32(28)44-31;2-1(3,4)5/h11-19H,9-10H2,1-8H3,(H-,40,41,42,43);(H,2,3,4,5) |
| InChIKey | PWZJEXGKUHVUFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 590 meta-isomer (CHEBI:51821) has part ATTO 590 meta-isomer(1+) (CHEBI:52799) |
| ATTO 590 meta-isomer (CHEBI:51821) is a ATTO 590 (CHEBI:51820) |
| IUPAC Name |
|---|
| 6-(2,4-dicarboxyphenyl)-1,11-diethyl-2,2,4,8,10,10-hexamethyl-10,11-dihydro-2H-pyrano[3,2-g:5,6-g']diquinolin-1-ium perchlorate |
| Synonym | Source |
|---|---|
| ATTO 590 free 2,4-dicarboxylic acid | ChEBI |