EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N6O |
| Net Charge | 0 |
| Average Mass | 348.410 |
| Monoisotopic Mass | 348.16986 |
| SMILES | O=C(Nc1cccc(C2=NCCN2)c1)Nc1cccc(C2=NCCN2)c1 |
| InChI | InChI=1S/C19H20N6O/c26-19(24-15-5-1-3-13(11-15)17-20-7-8-21-17)25-16-6-2-4-14(12-16)18-22-9-10-23-18/h1-6,11-12H,7-10H2,(H,20,21)(H,22,23)(H2,24,25,26) |
| InChIKey | SCEVFJUWLLRELN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imidocarb (CHEBI:51804) has role antiprotozoal drug (CHEBI:35820) |
| imidocarb (CHEBI:51804) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1,3-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]urea |
| INNs | Source |
|---|---|
| imidocarb | ChemIDplus |
| imidocarbe | ChemIDplus |
| imidocarbo | ChemIDplus |
| imidocarbum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,3-Bis(3-(2-imidazolin-2-yl)phenyl)harnstoff | ChemIDplus |
| 1,3-bis(3-(2-imidazolin-2-yl)phenyl)urea | ChemIDplus |
| N,N'-bis(3-(4,5-dihydro-1H-imidazol-2-yl)phenyl)urea | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:964732 | Beilstein |
| CAS:27885-92-3 | ChemIDplus |