EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N3O2.ClO4 |
| Net Charge | 0 |
| Average Mass | 451.907 |
| Monoisotopic Mass | 451.15101 |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3[n+](CCCC(=O)O)c2c1.O=Cl(=O)(=O)[O-] |
| InChI | InChI=1S/C21H25N3O2.ClHO4/c1-22(2)17-9-7-15-12-16-8-10-18(23(3)4)14-20(16)24(19(15)13-17)11-5-6-21(25)26;2-1(3,4)5/h7-10,12-14H,5-6,11H2,1-4H3;(H,2,3,4,5) |
| InChIKey | KCYUESOHZRSRGP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 495-2 (CHEBI:51801) has functional parent ATTO 465-2 (CHEBI:51787) |
| ATTO 495-2 (CHEBI:51801) has part ATTO 495-2(1+) (CHEBI:52793) |
| ATTO 495-2 (CHEBI:51801) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| ATTO 495-3 (CHEBI:51806) has functional parent ATTO 495-2 (CHEBI:51801) |
| ATTO 495-4 (CHEBI:51809) has functional parent ATTO 495-2 (CHEBI:51801) |
| ATTO 495-7 (CHEBI:51810) has functional parent ATTO 495-2 (CHEBI:51801) |
| IUPAC Name |
|---|
| 10-(3-carboxypropyl)-3,6-bis(dimethylamino)acridinium perchlorate |
| Synonym | Source |
|---|---|
| ATTO 495 free acid | ChEBI |