EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H14O11 |
| Net Charge | 0 |
| Average Mass | 478.365 |
| Monoisotopic Mass | 478.05361 |
| SMILES | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(cc4oc5cc(O)cc(O)c5c4c2O)O3)c1 |
| InChI | InChI=1S/C24H14O11/c25-8-1-9(26)3-11(2-8)32-21-13(29)6-14(30)22-24(21)35-23-17(34-22)7-16-19(20(23)31)18-12(28)4-10(27)5-15(18)33-16/h1-7,25-31H |
| InChIKey | RGNBIKVVGUORSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fucofuroeckol B (CHEBI:5180) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| Fucofuroeckol B | KEGG COMPOUND |