EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO6 |
| Net Charge | 0 |
| Average Mass | 401.459 |
| Monoisotopic Mass | 401.18384 |
| SMILES | CCOC(=O)c1cc2cc3c(cc2oc1=O)N(CCCC(=O)O)C(C)(C)CC3C |
| InChI | InChI=1S/C22H27NO6/c1-5-28-20(26)16-10-14-9-15-13(2)12-22(3,4)23(8-6-7-19(24)25)17(15)11-18(14)29-21(16)27/h9-11,13H,5-8,12H2,1-4H3,(H,24,25) |
| InChIKey | WNDDWSAHNYBXKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATTO 425-2 (CHEBI:51783) has role fluorochrome (CHEBI:51217) |
| ATTO 425-2 (CHEBI:51783) is a 7-aminocoumarins (CHEBI:51769) |
| ATTO 425-2 (CHEBI:51783) is a dicarboxylic acid monoester (CHEBI:36244) |
| ATTO 425-2 (CHEBI:51783) is a ethyl ester (CHEBI:23990) |
| ATTO 425-2 (CHEBI:51783) is a organic heterotricyclic compound (CHEBI:26979) |
| Incoming Relation(s) |
| ATTO 425-3 (CHEBI:51784) has functional parent ATTO 425-2 (CHEBI:51783) |
| ATTO 425-4 (CHEBI:51785) has functional parent ATTO 425-2 (CHEBI:51783) |
| ATTO 425-7 (CHEBI:51786) has functional parent ATTO 425-2 (CHEBI:51783) |
| IUPAC Name |
|---|
| 4-[3-(ethoxycarbonyl)-6,8,8-trimethyl-2-oxo-7,8-dihydro-2H-pyrano[3,2-g]quinolin-9(6H)-yl]butanoic acid |
| Synonym | Source |
|---|---|
| ATTO 425 free acid | ChEBI |