EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C17H19N3.Cl |
| Net Charge | 0 |
| Average Mass | 301.821 |
| Monoisotopic Mass | 301.13458 |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3nc2c1.[Cl-].[H+] |
| InChI | InChI=1S/C17H19N3.ClH/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14;/h5-11H,1-4H3;1H |
| InChIKey | VSTHNGLPHBTRMB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine orange (CHEBI:51739) has part acridine orange cation (CHEBI:52788) |
| acridine orange (CHEBI:51739) has role fluorochrome (CHEBI:51217) |
| acridine orange (CHEBI:51739) has role histological dye (CHEBI:77178) |
| acridine orange (CHEBI:51739) is a aminoacridines (CHEBI:51803) |
| acridine orange (CHEBI:51739) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N,N',N'-tetramethylacridine-3,6-diamine hydrochloride |
| Synonyms | Source |
|---|---|
| 3,6-Bis(dimethylamino)acridine hydrochloride | ChemIDplus |
| Rhoduline Orange | ChemIDplus |
| N3,N3,N6,N6-tetramethyl-3,6-Acridinediamine hydrochloride(1:1) | ChEBI |
| 3,6-Bis(dimethylamino)acridine | KEGG COMPOUND |
| C.I. 46005 | ChEBI |
| basic orange 14 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C19315 | KEGG COMPOUND |
| Acridine_orange | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3575587 | Beilstein |
| CAS:65-61-2 | ChemIDplus |
| CAS:494-38-2 | KEGG COMPOUND |