EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O4 |
| Net Charge | 0 |
| Average Mass | 386.532 |
| Monoisotopic Mass | 386.24571 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@]3(O)CC[C@]4([H])c3ccc(=O)oc3)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C24H34O4/c1-22-10-7-17(25)13-16(22)4-5-20-19(22)8-11-23(2)18(9-12-24(20,23)27)15-3-6-21(26)28-14-15/h3,6,14,16-20,25,27H,4-5,7-13H2,1-2H3/t16-,17+,18-,19+,20-,22+,23-,24+/m1/s1 |
| InChIKey | QEEBRPGZBVVINN-BMPKRDENSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bufo bufo (ncbitaxon:8384) | - | PubMed (21185919) |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bufalin (CHEBI:517248) has functional parent bufanolide (CHEBI:22934) |
| bufalin (CHEBI:517248) has role animal metabolite (CHEBI:75767) |
| bufalin (CHEBI:517248) has role anti-inflammatory agent (CHEBI:67079) |
| bufalin (CHEBI:517248) has role antineoplastic agent (CHEBI:35610) |
| bufalin (CHEBI:517248) has role cardiotonic drug (CHEBI:38147) |
| bufalin (CHEBI:517248) is a 14β-hydroxy steroid (CHEBI:36862) |
| bufalin (CHEBI:517248) is a 3β-hydroxy steroid (CHEBI:36836) |
| IUPAC Name |
|---|
| (3β,5β)-3,14-dihydroxybufa-20,22-dienolide |
| Synonyms | Source |
|---|---|
| 3,14-Dihydroxy-bufa-20,22-dienolide | ChemIDplus |
| 3-beta,14-Dihydroxy-5-beta-bufa-20,22-dienolide | ChemIDplus |
| 3β,14β-dihydroxy-5β-bufa-20,22-dienolide | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C16922 | KEGG COMPOUND |
| LMST01130001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96550 | Reaxys |
| CAS:465-21-4 | KEGG COMPOUND |
| CAS:465-21-4 | ChemIDplus |
| Citations |
|---|