EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O10 |
| Net Charge | 0 |
| Average Mass | 370.310 |
| Monoisotopic Mass | 370.09000 |
| SMILES | COc1cc2ccc(=O)oc2c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C16H18O10/c1-23-7-4-6-2-3-9(18)25-14(6)15(11(7)20)26-16-13(22)12(21)10(19)8(5-17)24-16/h2-4,8,10,12-13,16-17,19-22H,5H2,1H3/t8-,10-,12+,13-,16+/m1/s1 |
| InChIKey | CRSFLLTWRCYNNX-QBNNUVSCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acer tegmentosum (ncbitaxon:57653) | - | PubMed (28383514) | |
| Aesculus hippocastanum (ncbitaxon:43364) | seed (BTO:0001226) | PubMed (32649293) | |
| Fraxinus excelsior (ncbitaxon:38873) | leaf (BTO:0000713) | PubMed (1298368) | |
| Tilia platyphyllos (ncbitaxon:82423) | - | PubMed (31273573) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fraxin (CHEBI:5170) has functional parent fraxetin (CHEBI:5169) |
| fraxin (CHEBI:5170) has role anti-inflammatory agent (CHEBI:67079) |
| fraxin (CHEBI:5170) has role hepatoprotective agent (CHEBI:62868) |
| fraxin (CHEBI:5170) has role plant metabolite (CHEBI:76924) |
| fraxin (CHEBI:5170) is a aromatic ether (CHEBI:35618) |
| fraxin (CHEBI:5170) is a hydroxycoumarin (CHEBI:37912) |
| fraxin (CHEBI:5170) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 7-hydroxy-6-methoxy-2-oxo-2H-chromen-8-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 8-(β-D-glucopyranosyloxy)-7-hydroxy-6-methoxy-2H-1-benzopyran-2-one | ChemIDplus |
| fraxetin-8-O-glucoside | ChemIDplus |
| fraxetin-8-O-β-D-glucopyranoside | ChEBI |
| fraxetin-8-O-β-D-glucoside | ChEBI |
| fraxetin-8-β-D-glucopyranoside | ChEBI |
| fraxin | ChemIDplus |
| Citations |
|---|