EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H12 |
| Net Charge | 0 |
| Average Mass | 228.294 |
| Monoisotopic Mass | 228.09390 |
| SMILES | c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H |
| InChIKey | WDECIBYCCFPHNR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | DOI (10.1016/j.foodchem.2013.08.121) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chrysene (CHEBI:51687) has role plant metabolite (CHEBI:76924) |
| chrysene (CHEBI:51687) is a ortho-fused polycyclic arene (CHEBI:35296) |
| Incoming Relation(s) |
| hydroxychrysene (CHEBI:132400) has parent hydride chrysene (CHEBI:51687) |
| IUPAC Name |
|---|
| chrysene |
| Synonyms | Source |
|---|---|
| benzo[a]phenanthrene | NIST Chemistry WebBook |
| Chrysen | ChEBI |
| 1,2,5,6-dibenzonaphthalene | NIST Chemistry WebBook |
| Benz[a]phenanthrene | KEGG COMPOUND |
| Chrysene | KEGG COMPOUND |
| 1,2-Benzophenanthrene | KEGG COMPOUND |
| Citations |
|---|