EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H18 |
| Net Charge | 0 |
| Average Mass | 330.430 |
| Monoisotopic Mass | 330.14085 |
| SMILES | c1ccc(-c2c3ccccc3c(-c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H18/c1-3-11-19(12-4-1)25-21-15-7-9-17-23(21)26(20-13-5-2-6-14-20)24-18-10-8-16-22(24)25/h1-18H |
| InChIKey | FCNCGHJSNVOIKE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-diphenylanthracene (CHEBI:51676) has role fluorochrome (CHEBI:51217) |
| 9,10-diphenylanthracene (CHEBI:51676) has role photosensitizing agent (CHEBI:47868) |
| 9,10-diphenylanthracene (CHEBI:51676) is a anthracenes (CHEBI:46955) |
| IUPAC Name |
|---|
| 9,10-diphenylanthracene |
| Synonyms | Source |
|---|---|
| Anthracene, 9,10-diphenyl- | ChemIDplus |
| DPA | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 9,10-Diphenylanthracene | Wikipedia |