EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H22NO |
| Net Charge | +1 |
| Average Mass | 388.490 |
| Monoisotopic Mass | 388.16959 |
| SMILES | c1ccc(COc2c(-c3ccccc3)cc(-c3ccccc3)c3ccc[nH+]c23)cc1 |
| InChI | InChI=1S/C28H21NO/c1-4-11-21(12-5-1)20-30-28-26(23-15-8-3-9-16-23)19-25(22-13-6-2-7-14-22)24-17-10-18-29-27(24)28/h1-19H,20H2/p+1 |
| InChIKey | GBFCRECCLKGFGJ-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-benzyloxy-5,7-diphenylquinoline(1+) (CHEBI:51674) is a organic cation (CHEBI:25697) |
| 8-benzyloxy-5,7-diphenylquinoline(1+) (CHEBI:51674) is conjugate acid of 8-benzyloxy-5,7-diphenylquinoline (CHEBI:51673) |
| Incoming Relation(s) |
| 8-benzyloxy-5,7-diphenylquinoline (CHEBI:51673) is conjugate base of 8-benzyloxy-5,7-diphenylquinoline(1+) (CHEBI:51674) |
| IUPAC Name |
|---|
| 8-(benzyloxy)-5,7-diphenylquinolinium |
| Synonym | Source |
|---|---|
| 8-Benzyloxy-5,7-diphenylquinoline protonated | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11044600 | Beilstein |