EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7O4P.C4H11NO3 |
| Net Charge | 0 |
| Average Mass | 259.195 |
| Monoisotopic Mass | 259.08209 |
| SMILES | C[C@@H]1O[C@@H]1P(=O)(O)O.NC(CO)(CO)CO |
| InChI | InChI=1S/C4H11NO3.C3H7O4P/c5-4(1-6,2-7)3-8;1-2-3(7-2)8(4,5)6/h6-8H,1-3,5H2;2-3H,1H3,(H2,4,5,6)/t;2-,3+/m.0/s1 |
| InChIKey | QZJIMDIBFFHQDW-LMLSDSMGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fosfomycin tromethamine (CHEBI:5162) is a phosphonoacetic acid (CHEBI:15732) |
| Synonym | Source |
|---|---|
| Fosfomycin tromethamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00925 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:78964-85-9 | KEGG COMPOUND |