EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16N2O2 |
| Net Charge | 0 |
| Average Mass | 268.316 |
| Monoisotopic Mass | 268.12118 |
| SMILES | [H]C(=C([H])c1ccc([N+](=O)[O-])cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-17(2)15-9-5-13(6-10-15)3-4-14-7-11-16(12-8-14)18(19)20/h3-12H,1-2H3 |
| InChIKey | NVLSIZITFJRWPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-dimethylamino-4'-nitrostilbene (CHEBI:51615) has role fluorochrome (CHEBI:51217) |
| 4-dimethylamino-4'-nitrostilbene (CHEBI:51615) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| N,N-dimethyl-4-[2-(4-nitrophenyl)ethenyl]aniline |
| Synonyms | Source |
|---|---|
| Benzenamine, N,N-dimethyl-4-(2-(4-nitrophenyl)ethenyl)- | ChemIDplus |
| Amino-Nitrostilbene | ChEBI |
| N,N-dimethyl-4-[2-(4-nitrophenyl)vinyl]aniline | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1820958 | Beilstein |
| CAS:4584-57-0 | ChemIDplus |