EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H12N6 |
| Net Charge | -2 |
| Average Mass | 384.402 |
| Monoisotopic Mass | 384.11344 |
| SMILES | c1ccc2c(c1)-c1nc-2nc2[n-]c(nc3[n-]c(n1)c1ccccc13)c1ccccc21 |
| InChI | InChI=1S/C24H12N6/c1-2-8-14-13(7-1)19-25-20(14)29-22-17-11-5-6-12-18(17)24(27-22)30-23-16-10-4-3-9-15(16)21(26-23)28-19/h1-12H/q-2 |
| InChIKey | GOPACOBFGLQZSF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| subphthalocyaninate(2−) (CHEBI:51591) is a subphthalocyanines (CHEBI:51589) |
| subphthalocyaninate(2−) (CHEBI:51591) is conjugate base of subphthalocyanine (CHEBI:51587) |
| Incoming Relation(s) |
| subphthalocyanine (CHEBI:51587) is conjugate acid of subphthalocyaninate(2−) (CHEBI:51591) |
| IUPAC Name |
|---|
| (1Z,10Z,20Z)-2,11,20,28,29,30-hexaazaheptacyclo[19.6.1.13,10.112,19.04,9.013,18.022,27]triaconta-1,3(30),4,6,8,10,12,14,16,18,20,22,24,26-tetradecaene-28,29-diide |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11082766 | Beilstein |