EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4 |
| Net Charge | 0 |
| Average Mass | 116.072 |
| Monoisotopic Mass | 116.01096 |
| SMILES | O=CCC(=O)C(=O)O |
| InChI | InChI=1S/C4H4O4/c5-2-1-3(6)4(7)8/h2H,1H2,(H,7,8) |
| InChIKey | YEZSWHPLZBZVLH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Formylpyruvate (CHEBI:5159) is a oxo carboxylic acid (CHEBI:25754) |
| Synonym | Source |
|---|---|
| Formylpyruvate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02150 | KEGG COMPOUND |