EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H18N2O5 |
| Net Charge | 0 |
| Average Mass | 438.439 |
| Monoisotopic Mass | 438.12157 |
| SMILES | O=C(O)COc1cccc(-c2ocnc2-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C26H18N2O5/c29-21(30)15-31-20-13-7-12-19(14-20)24-23(27-16-32-24)26-28-22(17-8-3-1-4-9-17)25(33-26)18-10-5-2-6-11-18/h1-14,16H,15H2,(H,29,30) |
| InChIKey | DSRSEEYZGWTODH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | partial prostacyclin agonist A compound which binds and activates the prostacyclin receptor IP1, but has only partial efficacy at the receptor relative to a full agonist. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMY 45778 (CHEBI:51544) has role partial prostacyclin agonist (CHEBI:51577) |
| BMY 45778 (CHEBI:51544) is a bisoxazole (CHEBI:51562) |
| IUPAC Name |
|---|
| [3-(4,5-diphenyl-2,4'-bi-1,3-oxazol-5'-yl)phenoxy]acetic acid |
| Synonyms | Source |
|---|---|
| Bmy 45778 | ChemIDplus |
| Bmy-45778 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-3901 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6671146 | Beilstein |
| CAS:152575-66-1 | ChemIDplus |