EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51450 - bosentan
| Formula | C27H29N5O6S |
| Net Charge | 0 |
| Average Mass | 551.625 |
| Monoisotopic Mass | 551.18385 |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc(-c2ncccn2)nc1OCCO |
| InChI | InChI=1S/C27H29N5O6S/c1-27(2,3)18-10-12-19(13-11-18)39(34,35)32-23-22(38-21-9-6-5-8-20(21)36-4)26(37-17-16-33)31-25(30-23)24-28-14-7-15-29-24/h5-15,33H,16-17H2,1-4H3,(H,30,31,32) |
| InChIKey | GJPICJJJRGTNOD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. endothelin receptor antagonist A hormone antagonist that blocks endothelin receptors. hypoglycemic agent A drug which lowers the blood glucose level. anti-asthmatic agent Any compound that has anti-asthmatic effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bosentan (CHEBI:51450) has role anti-asthmatic agent (CHEBI:65023) |
| bosentan (CHEBI:51450) has role anti-ulcer drug (CHEBI:49201) |
| bosentan (CHEBI:51450) has role antifibrotic agent (CHEBI:233423) |
| bosentan (CHEBI:51450) has role antiglaucoma drug (CHEBI:39456) |
| bosentan (CHEBI:51450) has role antihypertensive agent (CHEBI:35674) |
| bosentan (CHEBI:51450) has role antineoplastic agent (CHEBI:35610) |
| bosentan (CHEBI:51450) has role cardiovascular drug (CHEBI:35554) |
| bosentan (CHEBI:51450) has role endothelin receptor antagonist (CHEBI:51451) |
| bosentan (CHEBI:51450) has role hepatoprotective agent (CHEBI:62868) |
| bosentan (CHEBI:51450) has role hypoglycemic agent (CHEBI:35526) |
| bosentan (CHEBI:51450) is a primary alcohol (CHEBI:15734) |
| bosentan (CHEBI:51450) is a pyrimidines (CHEBI:39447) |
| bosentan (CHEBI:51450) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| bosentan hydrate (CHEBI:31300) has part bosentan (CHEBI:51450) |
| IUPAC Name |
|---|
| 4-tert-butyl-N-[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)-2,2'-bipyrimidin-4-yl]benzenesulfonamide |
| INNs | Source |
|---|---|
| bosentan | WHO MedNet |
| bosentan | ChemIDplus |
| bosentán | WHO MedNet |
| bosentanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-(1,1-Dimethylethyl)-N-(6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)-(2,2'-bipyrimidin)-4-yl) benzenesulfornamide | ChemIDplus |
| Anhydrous bosentan | ChEMBL |
| Bosentan (as monohydrate) | ChEMBL |
| p-tert-Butyl-N-(6-(2-hydroxyethoxy)-5-(o-methoxyphenoxy)-2-(2-pyrimidinyl)-4-pyrimidinyl)benzenesulfonamide | ChemIDplus |
| RO 47-0203/029 | ChEMBL |
| RO-47-0203-029 | ChEMBL |
| Citations |
|---|