EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | [H][C@@]1([C@@H](O)CO)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m0/s1 |
| InChIKey | CIWBSHSKHKDKBQ-VHUNDSFISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-isoascorbic acid (CHEBI:51440) is a ascorbic acid (CHEBI:22652) |
| Incoming Relation(s) |
| monodehydro-L-ascorbic acid (CHEBI:16504) has functional parent L-isoascorbic acid (CHEBI:51440) |
| IUPAC Names |
|---|
| (5S)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one |
| L-erythro-hex-2-enono-1,4-lactone |
| Synonyms | Source |
|---|---|
| L-araboascorbic acid | ChEBI |
| L-Isoascorbinsäure | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:84274 | Beilstein |