EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H16 |
| Net Charge | 0 |
| Average Mass | 472.546 |
| Monoisotopic Mass | 472.12520 |
| SMILES | c1cc2ccc3c4ccc5ccc6ccc7ccc8c9ccc%10ccc1c1c2c3c(c9c%101)c1c4c5c6c7c81 |
| InChI | InChI=1S/C38H16/c1-5-19-9-13-23-25-15-11-21-7-3-18-4-8-22-12-16-26-24-14-10-20-6-2-17(1)27-29(19)33(23)37(34(24)30(20)27)38-35(25)31(21)28(18)32(22)36(26)38/h1-16H |
| InChIKey | BEWSIRCXMVBNRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| circumbiphenyl (CHEBI:51411) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| naphtho[7',8',1',2':5,10,4]anthra[1,9,8-abcd]coronene |
| Synonym | Source |
|---|---|
| naphth[2',1',8',7':4,10,5]anthra[1,9,8-abcd]coronene | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2341984 | Beilstein |
| CAS:41163-25-1 | NIST Chemistry WebBook |
| CAS:41163-25-1 | ChemIDplus |